C54H39BN6OPt — CID 155616281
CID 155616281 (PubChem CID 155616281) has the molecular formula C54H39BN6OPt and a molecular weight of 993.84 g/mol.
| Compound Name | CID 155616281 |
|---|---|
| PubChem CID | 155616281 |
| Molecular Formula | C54H39BN6OPt |
| Molecular Weight | 993.84 g/mol |
| Exact Mass | 993.29 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)N4B(N(c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc64)n4ccnc4-5)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C54H39BN6O.Pt/c1-54(2,3)38-29-30-56-51(33-38)59-46-22-11-10-19-43(46)44-27-25-40(35-50(44)59)62-39-26-28-47-45(34-39)53-57-31-32-58(53)55-60(47)48-23-12-13-24-49(48)61(55)52-41(36-15-6-4-7-16-36)20-14-21-42(52)37-17-8-5-9-18-37;/h4-33H,1-3H3;/q-2;+2 |
| InChIKey | FATBGTKGRNFGCV-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.84 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|