C48H35BN6O2Pt — CID 166589295
CID 166589295 (PubChem CID 166589295) has the molecular formula C48H35BN6O2Pt and a molecular weight of 933.74 g/mol.
| Compound Name | CID 166589295 |
|---|---|
| PubChem CID | 166589295 |
| Molecular Formula | C48H35BN6O2Pt |
| Molecular Weight | 933.74 g/mol |
| Exact Mass | 933.26 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c5c(cc4)N4B(N(c6ccccc6)c6ccccc6Oc6ccccc64)n4ccnc4-5)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C48H35BN6O2.Pt/c1-48(2,3)32-25-26-50-46(29-32)53-39-16-8-7-15-36(39)37-23-21-35(31-43(37)53)56-34-22-24-40-38(30-34)47-51-27-28-52(47)49-54(33-13-5-4-6-14-33)41-17-9-11-19-44(41)57-45-20-12-10-18-42(45)55(40)49;/h4-29H,1-3H3;/q-2;+2 |
| InChIKey | DRLGCHOCWIVWCP-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 60.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.74 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|