C66H50N4O2Pt — CID 171051732
CID 171051732 (PubChem CID 171051732) has the molecular formula C66H50N4O2Pt and a molecular weight of 1126.23 g/mol.
| Compound Name | CID 171051732 |
|---|---|
| PubChem CID | 171051732 |
| Molecular Formula | C66H50N4O2Pt |
| Molecular Weight | 1126.23 g/mol |
| Exact Mass | 1125.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-c5nccn5-c5ccc(-c6ccccc6)cc5C(C)(C)C)c5oc6ccc7c8cc(-c9ccccc9)ccc8ccc7c6c5c4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C66H50N4O2.Pt/c1-65(2,3)46-31-32-67-61(37-46)70-57-20-14-13-19-50(57)51-27-25-47(40-59(51)70)71-48-38-54-62-52-26-23-43-21-22-44(41-15-9-7-10-16-41)35-53(43)49(52)28-30-60(62)72-63(54)55(39-48)64-68-33-34-69(64)58-29-24-45(36-56(58)66(4,5)6)42-17-11-8-12-18-42;/h7-38H,1-6H3;/q-2;+2 |
| InChIKey | TVDSGFKUBRTHFI-UHFFFAOYSA-N |
| XLogP | 17.56 |
| TPSA | 58.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1126.23 |
| LogP ≤ 5 | 17.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|