C33H21BN6OPt — CID 155616457
CID 155616457 (PubChem CID 155616457) has the molecular formula C33H21BN6OPt and a molecular weight of 723.46 g/mol.
| Compound Name | CID 155616457 |
|---|---|
| PubChem CID | 155616457 |
| Molecular Formula | C33H21BN6OPt |
| Molecular Weight | 723.46 g/mol |
| Exact Mass | 723.15 |
| IUPAC Name | — |
| SMILES | CN1B2N(c3ccc(Oc4[c-]c5c(cc4)c4ccccc4n5-c4ccccn4)[c-]c3-c3nccn32)c2ccccc21.[Pt+2] |
| InChI | InChI=1S/C33H21BN6O.Pt/c1-37-29-10-4-5-11-30(29)40-28-16-14-22(20-26(28)33-36-18-19-38(33)34(37)40)41-23-13-15-25-24-8-2-3-9-27(24)39(31(25)21-23)32-12-6-7-17-35-32;/h2-19H,1H3;/q-2;+2 |
| InChIKey | PJLIDCVSXXQKSK-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 51.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.46 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|