C23H25N3O7S — CID 169078811
N-[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methoxy]ethyl]prop-2-ynamide (PubChem CID 169078811) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is N-[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methoxy]ethyl]prop-2-ynamide.
| Compound Name | N-[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methoxy]ethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 169078811 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N-[2-[[3-[(5-ethyl-2-methoxyphenyl)sulfonylamino]-4-methoxy-1,2-benzoxazol-6-yl]methoxy]ethyl]prop-2-ynamide |
| SMILES | C#CC(=O)NCCOCc1cc(OC)c2c(NS(=O)(=O)c3cc(CC)ccc3OC)noc2c1 |
| InChI | InChI=1S/C23H25N3O7S/c1-5-15-7-8-17(30-3)20(13-15)34(28,29)26-23-22-18(31-4)11-16(12-19(22)33-25-23)14-32-10-9-24-21(27)6-2/h2,7-8,11-13H,5,9-10,14H2,1,3-4H3,(H,24,27)(H,25,26) |
| InChIKey | HLFSDMLCTWVJGV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 128.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|