C18H20N2O5S — CID 146288847
N-(6-ethoxy-1,2-benzoxazol-3-yl)-5-ethyl-2-methoxybenzenesulfonamide (PubChem CID 146288847) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is N-(6-ethoxy-1,2-benzoxazol-3-yl)-5-ethyl-2-methoxybenzenesulfonamide.
| Compound Name | N-(6-ethoxy-1,2-benzoxazol-3-yl)-5-ethyl-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 146288847 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-(6-ethoxy-1,2-benzoxazol-3-yl)-5-ethyl-2-methoxybenzenesulfonamide |
| SMILES | CCOc1ccc2c(NS(=O)(=O)c3cc(CC)ccc3OC)noc2c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-4-12-6-9-15(23-3)17(10-12)26(21,22)20-18-14-8-7-13(24-5-2)11-16(14)25-19-18/h6-11H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | DDYZGVZBUYMJOY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |