C19H14FNO6S — CID 169079070
(2-fluorophenyl)sulfonyl 6-[(prop-2-enoylamino)methyl]-1-benzofuran-2-carboxylate (PubChem CID 169079070) has the molecular formula C19H14FNO6S and a molecular weight of 403.39 g/mol. Its IUPAC name is (2-fluorophenyl)sulfonyl 6-[(prop-2-enoylamino)methyl]-1-benzofuran-2-carboxylate.
| Compound Name | (2-fluorophenyl)sulfonyl 6-[(prop-2-enoylamino)methyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 169079070 |
| Molecular Formula | C19H14FNO6S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (2-fluorophenyl)sulfonyl 6-[(prop-2-enoylamino)methyl]-1-benzofuran-2-carboxylate |
| SMILES | C=CC(=O)NCc1ccc2cc(C(=O)OS(=O)(=O)c3ccccc3F)oc2c1 |
| InChI | InChI=1S/C19H14FNO6S/c1-2-18(22)21-11-12-7-8-13-10-16(26-15(13)9-12)19(23)27-28(24,25)17-6-4-3-5-14(17)20/h2-10H,1,11H2,(H,21,22) |
| InChIKey | PHZJEYZVXFMWND-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|