C23H28N2O4 — CID 169079163
tert-butyl 3-[2-(3-methoxycarbonyl-5-methylphenyl)-4-pyridinyl]pyrrolidine-1-carboxylate (PubChem CID 169079163) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-methoxycarbonyl-5-methylphenyl)-4-pyridinyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(3-methoxycarbonyl-5-methylphenyl)-4-pyridinyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169079163 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | tert-butyl 3-[2-(3-methoxycarbonyl-5-methylphenyl)-4-pyridinyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)c1cc(C)cc(-c2cc(C3CCN(C(=O)OC(C)(C)C)C3)ccn2)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-15-10-18(12-19(11-15)21(26)28-5)20-13-16(6-8-24-20)17-7-9-25(14-17)22(27)29-23(2,3)4/h6,8,10-13,17H,7,9,14H2,1-5H3 |
| InChIKey | JIPQJLLELDISTC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |