C31H35FN4O5 — CID 169079687
tert-butyl 2-(2,6-diethylphenyl)-3-(6-fluoro-7-methylperoxycarbonyl-1H-indol-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 169079687) has the molecular formula C31H35FN4O5 and a molecular weight of 562.64 g/mol. Its IUPAC name is tert-butyl 2-(2,6-diethylphenyl)-3-(6-fluoro-7-methylperoxycarbonyl-1H-indol-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-(2,6-diethylphenyl)-3-(6-fluoro-7-methylperoxycarbonyl-1H-indol-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 169079687 |
| Molecular Formula | C31H35FN4O5 |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | tert-butyl 2-(2,6-diethylphenyl)-3-(6-fluoro-7-methylperoxycarbonyl-1H-indol-4-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(C(=O)OOC)c3[nH]ccc13)CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C31H35FN4O5/c1-7-18-10-9-11-19(8-2)27(18)36-28(22-17-35(15-13-24(22)34-36)30(38)40-31(3,4)5)21-16-23(32)25(29(37)41-39-6)26-20(21)12-14-33-26/h9-12,14,16,33H,7-8,13,15,17H2,1-6H3 |
| InChIKey | KTTHGUORKAIUCA-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|