C27H30F2N4O4 — CID 138698551
tert-butyl 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 138698551) has the molecular formula C27H30F2N4O4 and a molecular weight of 512.56 g/mol. Its IUPAC name is tert-butyl 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 138698551 |
| Molecular Formula | C27H30F2N4O4 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | tert-butyl 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c([N+](=O)[O-])cc1F)CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C27H30F2N4O4/c1-6-16-9-8-10-17(7-2)24(16)32-25(18-13-21(29)23(33(35)36)14-20(18)28)19-15-31(12-11-22(19)30-32)26(34)37-27(3,4)5/h8-10,13-14H,6-7,11-12,15H2,1-5H3 |
| InChIKey | GTVQFCFOQUTXFF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|