C30H29Cl2F2N5O — CID 139296838
[4-[5-[(2,4-dichlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea (PubChem CID 139296838) has the molecular formula C30H29Cl2F2N5O and a molecular weight of 584.50 g/mol. Its IUPAC name is [4-[5-[(2,4-dichlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea.
| Compound Name | [4-[5-[(2,4-dichlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
|---|---|
| PubChem CID | 139296838 |
| Molecular Formula | C30H29Cl2F2N5O |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | [4-[5-[(2,4-dichlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(NC(N)=O)cc1F)CN(Cc1ccc(Cl)cc1Cl)CC2 |
| InChI | InChI=1S/C30H29Cl2F2N5O/c1-3-17-6-5-7-18(4-2)28(17)39-29(21-13-25(34)27(14-24(21)33)36-30(35)40)22-16-38(11-10-26(22)37-39)15-19-8-9-20(31)12-23(19)32/h5-9,12-14H,3-4,10-11,15-16H2,1-2H3,(H3,35,36,40) |
| InChIKey | LHRVXIWBOOWHHQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |