C33H34F5N5O — CID 139296496
[4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea (PubChem CID 139296496) has the molecular formula C33H34F5N5O and a molecular weight of 611.66 g/mol. Its IUPAC name is [4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea.
| Compound Name | [4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
|---|---|
| PubChem CID | 139296496 |
| Molecular Formula | C33H34F5N5O |
| Molecular Weight | 611.66 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | [4-[2-(2,6-diethylphenyl)-6,6-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(NC(N)=O)cc1F)CN(Cc1ccc(C(F)(F)F)cc1)C(C)(C)C2 |
| InChI | InChI=1S/C33H34F5N5O/c1-5-20-8-7-9-21(6-2)29(20)43-30(23-14-26(35)27(15-25(23)34)40-31(39)44)24-18-42(32(3,4)16-28(24)41-43)17-19-10-12-22(13-11-19)33(36,37)38/h7-15H,5-6,16-18H2,1-4H3,(H3,39,40,44) |
| InChIKey | HPFCNZGKPAXTMS-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.66 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |