C33H33F6N5O — CID 139296373
[4-[2-(2,6-diethylphenyl)-5-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea (PubChem CID 139296373) has the molecular formula C33H33F6N5O and a molecular weight of 629.65 g/mol. Its IUPAC name is [4-[2-(2,6-diethylphenyl)-5-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea.
| Compound Name | [4-[2-(2,6-diethylphenyl)-5-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
|---|---|
| PubChem CID | 139296373 |
| Molecular Formula | C33H33F6N5O |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | [4-[2-(2,6-diethylphenyl)-5-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(NC(N)=O)cc1F)CN(Cc1ccc(F)cc1C(F)(F)F)C(C)(C)C2 |
| InChI | InChI=1S/C33H33F6N5O/c1-5-18-8-7-9-19(6-2)29(18)44-30(22-13-26(36)27(14-25(22)35)41-31(40)45)23-17-43(32(3,4)15-28(23)42-44)16-20-10-11-21(34)12-24(20)33(37,38)39/h7-14H,5-6,15-17H2,1-4H3,(H3,40,41,45) |
| InChIKey | YQIZYPVWOYMWOM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |