C32H34ClF2N5O — CID 139296235
[4-[5-[(2-chlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea (PubChem CID 139296235) has the molecular formula C32H34ClF2N5O and a molecular weight of 578.11 g/mol. Its IUPAC name is [4-[5-[(2-chlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea.
| Compound Name | [4-[5-[(2-chlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
|---|---|
| PubChem CID | 139296235 |
| Molecular Formula | C32H34ClF2N5O |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | [4-[5-[(2-chlorophenyl)methyl]-2-(2,6-diethylphenyl)-6,6-dimethyl-4,7-dihydropyrazolo[4,3-c]pyridin-3-yl]-2,5-difluorophenyl]urea |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c(NC(N)=O)cc1F)CN(Cc1ccccc1Cl)C(C)(C)C2 |
| InChI | InChI=1S/C32H34ClF2N5O/c1-5-19-11-9-12-20(6-2)29(19)40-30(22-14-26(35)27(15-25(22)34)37-31(36)41)23-18-39(32(3,4)16-28(23)38-40)17-21-10-7-8-13-24(21)33/h7-15H,5-6,16-18H2,1-4H3,(H3,36,37,41) |
| InChIKey | HRCDZCGGNZILPJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |