C22H23ClF2N4O2 — CID 138698526
2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride (PubChem CID 138698526) has the molecular formula C22H23ClF2N4O2 and a molecular weight of 448.90 g/mol. Its IUPAC name is 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride.
| Compound Name | 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 138698526 |
| Molecular Formula | C22H23ClF2N4O2 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 2-(2,6-diethylphenyl)-3-(2,5-difluoro-4-nitrophenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1cc(F)c([N+](=O)[O-])cc1F)CNCC2.Cl |
| InChI | InChI=1S/C22H22F2N4O2.ClH/c1-3-13-6-5-7-14(4-2)21(13)27-22(16-12-25-9-8-19(16)26-27)15-10-18(24)20(28(29)30)11-17(15)23;/h5-7,10-11,25H,3-4,8-9,12H2,1-2H3;1H |
| InChIKey | WVEAABZSDSOXTH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|