C25H28N4 — CID 170176414
2-(2,6-dimethylphenyl)-3-(1,6,7-trimethylindol-4-yl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 170176414) has the molecular formula C25H28N4 and a molecular weight of 384.53 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-3-(1,6,7-trimethylindol-4-yl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 2-(2,6-dimethylphenyl)-3-(1,6,7-trimethylindol-4-yl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 170176414 |
| Molecular Formula | C25H28N4 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-3-(1,6,7-trimethylindol-4-yl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | Cc1cccc(C)c1-n1nc2c(c1-c1cc(C)c(C)c3c1ccn3C)CNCC2 |
| InChI | InChI=1S/C25H28N4/c1-15-7-6-8-16(2)23(15)29-25(21-14-26-11-9-22(21)27-29)20-13-17(3)18(4)24-19(20)10-12-28(24)5/h6-8,10,12-13,26H,9,11,14H2,1-5H3 |
| InChIKey | WZHWQQKLXLAHED-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |