C27H28FN4O+ — CID 170176321
4'-[2-(2,6-diethylphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-5'-fluoro-7'-methoxyspiro[azirin-1-ium-1,1'-indol-1-ium] (PubChem CID 170176321) has the molecular formula C27H28FN4O+ and a molecular weight of 443.55 g/mol. Its IUPAC name is 4'-[2-(2,6-diethylphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-5'-fluoro-7'-methoxyspiro[azirin-1-ium-1,1'-indol-1-ium].
| Compound Name | 4'-[2-(2,6-diethylphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-5'-fluoro-7'-methoxyspiro[azirin-1-ium-1,1'-indol-1-ium] |
|---|---|
| PubChem CID | 170176321 |
| Molecular Formula | C27H28FN4O+ |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 4'-[2-(2,6-diethylphenyl)-4,5,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl]-5'-fluoro-7'-methoxyspiro[azirin-1-ium-1,1'-indol-1-ium] |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1c(F)cc(OC)c3c1C=C[N+]31C=C1)CNCC2 |
| InChI | InChI=1S/C27H28FN4O/c1-4-17-7-6-8-18(5-2)25(17)31-26(20-16-29-11-9-22(20)30-31)24-19-10-12-32(13-14-32)27(19)23(33-3)15-21(24)28/h6-8,10,12-15,29H,4-5,9,11,16H2,1-3H3/q+1 |
| InChIKey | IUMFNXRSNYDUON-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|