C24H27ClN4 — CID 170176191
8-chloro-15-ethyl-2,8-dimethyl-6,17,18,22-tetrazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),9,11,13,15,18-heptaene (PubChem CID 170176191) has the molecular formula C24H27ClN4 and a molecular weight of 406.96 g/mol. Its IUPAC name is 8-chloro-15-ethyl-2,8-dimethyl-6,17,18,22-tetrazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),9,11,13,15,18-heptaene.
| Compound Name | 8-chloro-15-ethyl-2,8-dimethyl-6,17,18,22-tetrazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),9,11,13,15,18-heptaene |
|---|---|
| PubChem CID | 170176191 |
| Molecular Formula | C24H27ClN4 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 8-chloro-15-ethyl-2,8-dimethyl-6,17,18,22-tetrazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),9,11,13,15,18-heptaene |
| SMILES | CCc1cccc2c1-n1nc3c(c1C1(C)C2=CC(C)(Cl)C2=C1CCN2)CNCC3 |
| InChI | InChI=1S/C24H27ClN4/c1-4-14-6-5-7-15-18-12-23(2,25)21-17(8-11-27-21)24(18,3)22-16-13-26-10-9-19(16)28-29(22)20(14)15/h5-7,12,26-27H,4,8-11,13H2,1-3H3 |
| InChIKey | XUIPKBBOFIWRCM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|