C28H25ClF3N7 — CID 170150532
8-chloro-15-ethyl-2,8-dimethyl-22-[5-(trifluoromethyl)pyrimidin-2-yl]-4,6,17,18,22-pentazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),5,9,11,13,15,18-octaene (PubChem CID 170150532) has the molecular formula C28H25ClF3N7 and a molecular weight of 552.00 g/mol. Its IUPAC name is 8-chloro-15-ethyl-2,8-dimethyl-22-[5-(trifluoromethyl)pyrimidin-2-yl]-4,6,17,18,22-pentazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),5,9,11,13,15,18-octaene.
| Compound Name | 8-chloro-15-ethyl-2,8-dimethyl-22-[5-(trifluoromethyl)pyrimidin-2-yl]-4,6,17,18,22-pentazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),5,9,11,13,15,18-octaene |
|---|---|
| PubChem CID | 170150532 |
| Molecular Formula | C28H25ClF3N7 |
| Molecular Weight | 552.00 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 8-chloro-15-ethyl-2,8-dimethyl-22-[5-(trifluoromethyl)pyrimidin-2-yl]-4,6,17,18,22-pentazahexacyclo[15.7.0.02,10.03,7.011,16.019,24]tetracosa-1(24),3(7),5,9,11,13,15,18-octaene |
| SMILES | CCc1cccc2c1-n1nc3c(c1C1(C)C2=CC(C)(Cl)c2nc[nH]c21)CN(c1ncc(C(F)(F)F)cn1)CC3 |
| InChI | InChI=1S/C28H25ClF3N7/c1-4-15-6-5-7-17-19-10-26(2,29)22-23(36-14-35-22)27(19,3)24-18-13-38(9-8-20(18)37-39(24)21(15)17)25-33-11-16(12-34-25)28(30,31)32/h5-7,10-12,14H,4,8-9,13H2,1-3H3,(H,35,36) |
| InChIKey | HTGLMBHHYAJVAF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.00 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|