C22H23N3O7 — CID 169079731
ethyl 4-[2,2-dimethoxyethyl-(7-nitro-1H-indole-2-carbonyl)amino]benzoate (PubChem CID 169079731) has the molecular formula C22H23N3O7 and a molecular weight of 441.44 g/mol. Its IUPAC name is ethyl 4-[2,2-dimethoxyethyl-(7-nitro-1H-indole-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[2,2-dimethoxyethyl-(7-nitro-1H-indole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 169079731 |
| Molecular Formula | C22H23N3O7 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | ethyl 4-[2,2-dimethoxyethyl-(7-nitro-1H-indole-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(CC(OC)OC)C(=O)c2cc3cccc([N+](=O)[O-])c3[nH]2)cc1 |
| InChI | InChI=1S/C22H23N3O7/c1-4-32-22(27)14-8-10-16(11-9-14)24(13-19(30-2)31-3)21(26)17-12-15-6-5-7-18(25(28)29)20(15)23-17/h5-12,19,23H,4,13H2,1-3H3 |
| InChIKey | MOSSRNHXERNCNC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|