C18H13FN2O2S — CID 169079871
ethyl 16-fluoro-2-thia-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10(18),11,13,15-octaene-11-carboxylate (PubChem CID 169079871) has the molecular formula C18H13FN2O2S and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 16-fluoro-2-thia-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10(18),11,13,15-octaene-11-carboxylate.
| Compound Name | ethyl 16-fluoro-2-thia-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10(18),11,13,15-octaene-11-carboxylate |
|---|---|
| PubChem CID | 169079871 |
| Molecular Formula | C18H13FN2O2S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | ethyl 16-fluoro-2-thia-9,13-diazatetracyclo[8.7.1.03,8.014,18]octadeca-1(17),3,5,7,10(18),11,13,15-octaene-11-carboxylate |
| SMILES | CCOC(=O)c1cnc2cc(F)cc3c2c1Nc1ccccc1S3 |
| InChI | InChI=1S/C18H13FN2O2S/c1-2-23-18(22)11-9-20-13-7-10(19)8-15-16(13)17(11)21-12-5-3-4-6-14(12)24-15/h3-9,21H,2H2,1H3 |
| InChIKey | OZBYHBOTVXIDBV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |