C20H24ClN5O3 — CID 169080843
3-[[2-[[2-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-1H-benzimidazol-4-yl]methyl]-1-methoxy-1-methylurea (PubChem CID 169080843) has the molecular formula C20H24ClN5O3 and a molecular weight of 417.90 g/mol. Its IUPAC name is 3-[[2-[[2-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-1H-benzimidazol-4-yl]methyl]-1-methoxy-1-methylurea.
| Compound Name | 3-[[2-[[2-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-1H-benzimidazol-4-yl]methyl]-1-methoxy-1-methylurea |
|---|---|
| PubChem CID | 169080843 |
| Molecular Formula | C20H24ClN5O3 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-[[2-[[2-(3-chlorophenyl)-1-hydroxypropan-2-yl]amino]-1H-benzimidazol-4-yl]methyl]-1-methoxy-1-methylurea |
| SMILES | CON(C)C(=O)NCc1cccc2[nH]c(NC(C)(CO)c3cccc(Cl)c3)nc12 |
| InChI | InChI=1S/C20H24ClN5O3/c1-20(12-27,14-7-5-8-15(21)10-14)25-18-23-16-9-4-6-13(17(16)24-18)11-22-19(28)26(2)29-3/h4-10,27H,11-12H2,1-3H3,(H,22,28)(H2,23,24,25) |
| InChIKey | VLCKMRPCWMPIAQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|