C25H34ClN5O4S — CID 176654422
[2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 176654422) has the molecular formula C25H34ClN5O4S and a molecular weight of 536.10 g/mol. Its IUPAC name is [2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176654422 |
| Molecular Formula | C25H34ClN5O4S |
| Molecular Weight | 536.10 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | [2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | CN(C)C(=O)NCc1cccc(N)c1SNC(=O)NC(C)(COC(=O)C(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H34ClN5O4S/c1-24(2,3)21(32)35-15-25(4,17-10-8-11-18(26)13-17)29-22(33)30-36-20-16(9-7-12-19(20)27)14-28-23(34)31(5)6/h7-13H,14-15,27H2,1-6H3,(H,28,34)(H2,29,30,33) |
| InChIKey | RFAIGONARSTLDY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.10 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|