C31H36F3N5O4S — CID 176654409
[2-[[2-amino-3-[(methylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[4-[3-(trifluoromethyl)phenyl]phenyl]propyl] 2,2-dimethylpropanoate (PubChem CID 176654409) has the molecular formula C31H36F3N5O4S and a molecular weight of 631.72 g/mol. Its IUPAC name is [2-[[2-amino-3-[(methylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[4-[3-(trifluoromethyl)phenyl]phenyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-3-[(methylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[4-[3-(trifluoromethyl)phenyl]phenyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176654409 |
| Molecular Formula | C31H36F3N5O4S |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | [2-[[2-amino-3-[(methylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[4-[3-(trifluoromethyl)phenyl]phenyl]propyl] 2,2-dimethylpropanoate |
| SMILES | CNC(=O)NCc1cccc(SNC(=O)NC(C)(COC(=O)C(C)(C)C)c2ccc(-c3cccc(C(F)(F)F)c3)cc2)c1N |
| InChI | InChI=1S/C31H36F3N5O4S/c1-29(2,3)26(40)43-18-30(4,22-14-12-19(13-15-22)20-8-6-10-23(16-20)31(32,33)34)38-28(42)39-44-24-11-7-9-21(25(24)35)17-37-27(41)36-5/h6-16H,17-18,35H2,1-5H3,(H2,36,37,41)(H2,38,39,42) |
| InChIKey | VTGDJPQNDVGLRS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|