C28H36F3N5O4S — CID 169080846
[2-[[2-amino-3-[(morpholine-4-carbonylamino)methyl]phenyl]carbamothioylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate (PubChem CID 169080846) has the molecular formula C28H36F3N5O4S and a molecular weight of 595.69 g/mol. Its IUPAC name is [2-[[2-amino-3-[(morpholine-4-carbonylamino)methyl]phenyl]carbamothioylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-3-[(morpholine-4-carbonylamino)methyl]phenyl]carbamothioylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 169080846 |
| Molecular Formula | C28H36F3N5O4S |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | [2-[[2-amino-3-[(morpholine-4-carbonylamino)methyl]phenyl]carbamothioylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(C)(NC(=S)Nc1cccc(CNC(=O)N2CCOCC2)c1N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H36F3N5O4S/c1-26(2,3)23(37)40-17-27(4,19-8-6-9-20(15-19)28(29,30)31)35-24(41)34-21-10-5-7-18(22(21)32)16-33-25(38)36-11-13-39-14-12-36/h5-10,15H,11-14,16-17,32H2,1-4H3,(H,33,38)(H2,34,35,41) |
| InChIKey | IMORQKUUCKOOOU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|