C26H34F3N5O4S — CID 176654413
[2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate (PubChem CID 176654413) has the molecular formula C26H34F3N5O4S and a molecular weight of 569.65 g/mol. Its IUPAC name is [2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176654413 |
| Molecular Formula | C26H34F3N5O4S |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | [2-[[2-amino-6-[(dimethylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
| SMILES | CN(C)C(=O)NCc1cccc(N)c1SNC(=O)NC(C)(COC(=O)C(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H34F3N5O4S/c1-24(2,3)21(35)38-15-25(4,17-10-8-11-18(13-17)26(27,28)29)32-22(36)33-39-20-16(9-7-12-19(20)30)14-31-23(37)34(5)6/h7-13H,14-15,30H2,1-6H3,(H,31,37)(H2,32,33,36) |
| InChIKey | VZFZGZLTFKZBRF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|