C19H21F3N4O3S — CID 154633896
N-[(2R)-2-[(2-aminophenyl)sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]-2-methoxyacetamide (PubChem CID 154633896) has the molecular formula C19H21F3N4O3S and a molecular weight of 442.46 g/mol. Its IUPAC name is N-[(2R)-2-[(2-aminophenyl)sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]-2-methoxyacetamide.
| Compound Name | N-[(2R)-2-[(2-aminophenyl)sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 154633896 |
| Molecular Formula | C19H21F3N4O3S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[(2R)-2-[(2-aminophenyl)sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC[C@H](NC(=O)NSc1ccccc1N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N4O3S/c1-29-11-17(27)24-10-15(12-5-4-6-13(9-12)19(20,21)22)25-18(28)26-30-16-8-3-2-7-14(16)23/h2-9,15H,10-11,23H2,1H3,(H,24,27)(H2,25,26,28)/t15-/m0/s1 |
| InChIKey | MVTQOYPQHXJKNJ-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|