C32H45ClN4O6S — CID 169080865
[2-[[2-amino-6-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 169080865) has the molecular formula C32H45ClN4O6S and a molecular weight of 649.25 g/mol. Its IUPAC name is [2-[[2-amino-6-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-6-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 169080865 |
| Molecular Formula | C32H45ClN4O6S |
| Molecular Weight | 649.25 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | [2-[[2-amino-6-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccc(N)c1NC(=S)NC(C)(COC(=O)C(C)(C)C)c1cccc(Cl)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H45ClN4O6S/c1-29(2,3)25(38)41-19-32(10,21-14-12-15-22(33)17-21)36-26(44)35-24-20(13-11-16-23(24)34)18-37(27(39)42-30(4,5)6)28(40)43-31(7,8)9/h11-17H,18-19,34H2,1-10H3,(H2,35,36,44) |
| InChIKey | HJAXHFDRNSKKOD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.25 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|