C25H30ClN5O3S — CID 170537526
[2-[[2-amino-6-[(2-imino-1,3-oxazol-3-yl)methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 170537526) has the molecular formula C25H30ClN5O3S and a molecular weight of 516.07 g/mol. Its IUPAC name is [2-[[2-amino-6-[(2-imino-1,3-oxazol-3-yl)methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-6-[(2-imino-1,3-oxazol-3-yl)methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170537526 |
| Molecular Formula | C25H30ClN5O3S |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | [2-[[2-amino-6-[(2-imino-1,3-oxazol-3-yl)methyl]phenyl]carbamothioylamino]-2-(3-chlorophenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | [H]/N=c1\occn1Cc1cccc(N)c1NC(=S)NC(C)(COC(=O)C(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H30ClN5O3S/c1-24(2,3)21(32)34-15-25(4,17-8-6-9-18(26)13-17)30-23(35)29-20-16(7-5-10-19(20)27)14-31-11-12-33-22(31)28/h5-13,28H,14-15,27H2,1-4H3,(H2,29,30,35)/b28-22- |
| InChIKey | STEMPFRXVAIAHB-SLMZUGIISA-N |
| XLogP | 4.64 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|