C25H29ClFN5O4S — CID 170945396
[2-[[2-amino-3-[(1,3-oxazol-2-ylamino)methyl]phenyl]carbamoylsulfanylamino]-2-(3-chloro-4-fluorophenyl)propyl] 2,2-dimethylpropanoate (PubChem CID 170945396) has the molecular formula C25H29ClFN5O4S and a molecular weight of 550.06 g/mol. Its IUPAC name is [2-[[2-amino-3-[(1,3-oxazol-2-ylamino)methyl]phenyl]carbamoylsulfanylamino]-2-(3-chloro-4-fluorophenyl)propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-3-[(1,3-oxazol-2-ylamino)methyl]phenyl]carbamoylsulfanylamino]-2-(3-chloro-4-fluorophenyl)propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 170945396 |
| Molecular Formula | C25H29ClFN5O4S |
| Molecular Weight | 550.06 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | [2-[[2-amino-3-[(1,3-oxazol-2-ylamino)methyl]phenyl]carbamoylsulfanylamino]-2-(3-chloro-4-fluorophenyl)propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(C)(NSC(=O)Nc1cccc(CNc2ncco2)c1N)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C25H29ClFN5O4S/c1-24(2,3)21(33)36-14-25(4,16-8-9-18(27)17(26)12-16)32-37-23(34)31-19-7-5-6-15(20(19)28)13-30-22-29-10-11-35-22/h5-12,32H,13-14,28H2,1-4H3,(H,29,30)(H,31,34) |
| InChIKey | YTAYLBBJXWLGNA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.06 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|