C13H17ClFNO2 — CID 66089545
4-amino-3-(3-chloro-4-fluorophenyl)-3,4-dimethylpentanoic acid (PubChem CID 66089545) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.74 g/mol. Its IUPAC name is 4-amino-3-(3-chloro-4-fluorophenyl)-3,4-dimethylpentanoic acid.
| Compound Name | 4-amino-3-(3-chloro-4-fluorophenyl)-3,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 66089545 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-amino-3-(3-chloro-4-fluorophenyl)-3,4-dimethylpentanoic acid |
| SMILES | CC(C)(N)C(C)(CC(=O)O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClFNO2/c1-12(2,16)13(3,7-11(17)18)8-4-5-10(15)9(14)6-8/h4-6H,7,16H2,1-3H3,(H,17,18) |
| InChIKey | XHDCSXMXCVKZHE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |