C11H16ClNO2S — CID 66090953
4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid (PubChem CID 66090953) has the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. Its IUPAC name is 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid.
| Compound Name | 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 66090953 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid |
| SMILES | CC(C)(N)C(C)(CC(=O)O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H16ClNO2S/c1-10(2,13)11(3,6-9(14)15)7-4-5-8(12)16-7/h4-5H,6,13H2,1-3H3,(H,14,15) |
| InChIKey | NDTYBJWWKOGNNZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |