4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid

C11H16ClNO2S — CID 66090953

IUPAC4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid
SMILESCC(C)(N)C(C)(CC(=O)O)c1ccc(Cl)s1
InChIInChI=1S/C11H16ClNO2S/c1-10(2,13)11(3,6-9(14)15)7-4-5-8(12)16-7/h4-5H,6,13H2,1-3H3,(H,14,15)
InChIKeyNDTYBJWWKOGNNZ-UHFFFAOYSA-N
MW261.77 g/mol
LogP2.87
Rot. Bonds4

About 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid

4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid (PubChem CID 66090953) has the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. Its IUPAC name is 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid.

Molecular Properties

Compound Name4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid
PubChem CID66090953
Molecular FormulaC11H16ClNO2S
Molecular Weight261.77 g/mol
Exact Mass261.06
IUPAC Name4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid
SMILESCC(C)(N)C(C)(CC(=O)O)c1ccc(Cl)s1
InChIInChI=1S/C11H16ClNO2S/c1-10(2,13)11(3,6-9(14)15)7-4-5-8(12)16-7/h4-5H,6,13H2,1-3H3,(H,14,15)
InChIKeyNDTYBJWWKOGNNZ-UHFFFAOYSA-N
XLogP2.87
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.77
LogP ≤ 52.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid?
The IUPAC name of 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid (CID 66090953) is 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid.
What is the SMILES notation for 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid?
The canonical SMILES for 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid is CC(C)(N)C(C)(CC(=O)O)c1ccc(Cl)s1.
What is the InChIKey of 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid?
The InChIKey is NDTYBJWWKOGNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClNO2S/c1-10(2,13)11(3,6-9(14)15)7-4-5-8(12)16-7/h4-5H,6,13H2,1-3H3,(H,14,15).
What are the key properties of 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid?
4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid has a molecular weight of 261.77 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(5-chlorothiophen-2-yl)-3,4-dimethylpentanoic acid is sourced from PubChem (CID 66090953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).