C10H11F3O2S — CID 68906860
3-methyl-3-[5-(trifluoromethyl)thiophen-2-yl]butanoic acid (PubChem CID 68906860) has the molecular formula C10H11F3O2S and a molecular weight of 252.26 g/mol. Its IUPAC name is 3-methyl-3-[5-(trifluoromethyl)thiophen-2-yl]butanoic acid.
| Compound Name | 3-methyl-3-[5-(trifluoromethyl)thiophen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 68906860 |
| Molecular Formula | C10H11F3O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 3-methyl-3-[5-(trifluoromethyl)thiophen-2-yl]butanoic acid |
| SMILES | CC(C)(CC(=O)O)c1ccc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H11F3O2S/c1-9(2,5-8(14)15)6-3-4-7(16-6)10(11,12)13/h3-4H,5H2,1-2H3,(H,14,15) |
| InChIKey | ZKKCCQKFTVKOCW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |