C10H15ClN2OS — CID 115260344
2-[[2-(5-chlorothiophen-2-yl)-2-methylpropyl]amino]acetamide (PubChem CID 115260344) has the molecular formula C10H15ClN2OS and a molecular weight of 246.76 g/mol. Its IUPAC name is 2-[[2-(5-chlorothiophen-2-yl)-2-methylpropyl]amino]acetamide.
| Compound Name | 2-[[2-(5-chlorothiophen-2-yl)-2-methylpropyl]amino]acetamide |
|---|---|
| PubChem CID | 115260344 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-[[2-(5-chlorothiophen-2-yl)-2-methylpropyl]amino]acetamide |
| SMILES | CC(C)(CNCC(N)=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2OS/c1-10(2,6-13-5-9(12)14)7-3-4-8(11)15-7/h3-4,13H,5-6H2,1-2H3,(H2,12,14) |
| InChIKey | GHHGBAUJSLZTFO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |