C16H18F3NO2S — CID 165141640
[2-isothiocyanato-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate (PubChem CID 165141640) has the molecular formula C16H18F3NO2S and a molecular weight of 345.39 g/mol. Its IUPAC name is [2-isothiocyanato-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-isothiocyanato-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 165141640 |
| Molecular Formula | C16H18F3NO2S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [2-isothiocyanato-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(C)(N=C=S)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO2S/c1-14(2,3)13(21)22-9-15(4,20-10-23)11-6-5-7-12(8-11)16(17,18)19/h5-8H,9H2,1-4H3 |
| InChIKey | TXAZWVKHQYAJHY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|