C16H16F3NO3 — CID 102154827
ethyl (2S)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate (PubChem CID 102154827) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is ethyl (2S)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate.
| Compound Name | ethyl (2S)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate |
|---|---|
| PubChem CID | 102154827 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | ethyl (2S)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate |
| SMILES | CCOC(=O)[C@@](C#N)(CCC(C)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3NO3/c1-3-23-14(22)15(10-20,8-7-11(2)21)12-5-4-6-13(9-12)16(17,18)19/h4-6,9H,3,7-8H2,1-2H3/t15-/m1/s1 |
| InChIKey | DAYAOSOYKIZPDP-OAHLLOKOSA-N |
| XLogP | 3.40 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |