C18H20F3NO3 — CID 102590084
tert-butyl (2R)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate (PubChem CID 102590084) has the molecular formula C18H20F3NO3 and a molecular weight of 355.36 g/mol. Its IUPAC name is tert-butyl (2R)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate.
| Compound Name | tert-butyl (2R)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate |
|---|---|
| PubChem CID | 102590084 |
| Molecular Formula | C18H20F3NO3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | tert-butyl (2R)-2-cyano-5-oxo-2-[3-(trifluoromethyl)phenyl]hexanoate |
| SMILES | CC(=O)CC[C@@](C#N)(C(=O)OC(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3NO3/c1-12(23)8-9-17(11-22,15(24)25-16(2,3)4)13-6-5-7-14(10-13)18(19,20)21/h5-7,10H,8-9H2,1-4H3/t17-/m0/s1 |
| InChIKey | SQWJIZGCFUCGQX-KRWDZBQOSA-N |
| XLogP | 4.18 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |