C18H19F5O4 — CID 147888931
[3-(trifluoromethyl)phenyl] 2,2-difluoro-5-methyl-5-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 147888931) has the molecular formula C18H19F5O4 and a molecular weight of 394.34 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl] 2,2-difluoro-5-methyl-5-(2-methylprop-2-enoyloxy)hexanoate.
| Compound Name | [3-(trifluoromethyl)phenyl] 2,2-difluoro-5-methyl-5-(2-methylprop-2-enoyloxy)hexanoate |
|---|---|
| PubChem CID | 147888931 |
| Molecular Formula | C18H19F5O4 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [3-(trifluoromethyl)phenyl] 2,2-difluoro-5-methyl-5-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CCC(F)(F)C(=O)Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F5O4/c1-11(2)14(24)27-16(3,4)8-9-17(19,20)15(25)26-13-7-5-6-12(10-13)18(21,22)23/h5-7,10H,1,8-9H2,2-4H3 |
| InChIKey | IBWRXJAEIYBPGQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|