C27H34F3N5O4S — CID 176654417
[2-[[2-amino-3-[(cyclopropylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate (PubChem CID 176654417) has the molecular formula C27H34F3N5O4S and a molecular weight of 581.66 g/mol. Its IUPAC name is [2-[[2-amino-3-[(cyclopropylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[[2-amino-3-[(cyclopropylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176654417 |
| Molecular Formula | C27H34F3N5O4S |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | [2-[[2-amino-3-[(cyclopropylcarbamoylamino)methyl]phenyl]sulfanylcarbamoylamino]-2-[3-(trifluoromethyl)phenyl]propyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC(C)(NC(=O)NSc1cccc(CNC(=O)NC2CC2)c1N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H34F3N5O4S/c1-25(2,3)22(36)39-15-26(4,17-8-6-9-18(13-17)27(28,29)30)34-24(38)35-40-20-10-5-7-16(21(20)31)14-32-23(37)33-19-11-12-19/h5-10,13,19H,11-12,14-15,31H2,1-4H3,(H2,32,33,37)(H2,34,35,38) |
| InChIKey | PIBOUPHLRMOXAY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|