C12H18Cl3NO4 — CID 169081158
2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid (PubChem CID 169081158) has the molecular formula C12H18Cl3NO4 and a molecular weight of 346.64 g/mol. Its IUPAC name is 2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid.
| Compound Name | 2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 169081158 |
| Molecular Formula | C12H18Cl3NO4 |
| Molecular Weight | 346.64 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)propanoic acid |
| SMILES | CC(NC(=O)OCC(Cl)(Cl)Cl)(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C12H18Cl3NO4/c1-11(9(17)18,8-5-3-2-4-6-8)16-10(19)20-7-12(13,14)15/h8H,2-7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | APIIWNWHALLAKY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|