C15H18BN3O3 — CID 169082285
[4-[(2S)-2-amino-3-oxo-3-(pyridin-2-ylmethylamino)propyl]phenyl]boronic acid (PubChem CID 169082285) has the molecular formula C15H18BN3O3 and a molecular weight of 299.14 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxo-3-(pyridin-2-ylmethylamino)propyl]phenyl]boronic acid.
| Compound Name | [4-[(2S)-2-amino-3-oxo-3-(pyridin-2-ylmethylamino)propyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 169082285 |
| Molecular Formula | C15H18BN3O3 |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxo-3-(pyridin-2-ylmethylamino)propyl]phenyl]boronic acid |
| SMILES | N[C@@H](Cc1ccc(B(O)O)cc1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C15H18BN3O3/c17-14(9-11-4-6-12(7-5-11)16(21)22)15(20)19-10-13-3-1-2-8-18-13/h1-8,14,21-22H,9-10,17H2,(H,19,20)/t14-/m0/s1 |
| InChIKey | OJYQUWBAUDKCML-AWEZNQCLSA-N |
| XLogP | -1.05 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|