C13H20N4O3 — CID 169083058
tert-butyl 2-(6-oxo-1H-pyrimidin-5-yl)piperazine-1-carboxylate (PubChem CID 169083058) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is tert-butyl 2-(6-oxo-1H-pyrimidin-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(6-oxo-1H-pyrimidin-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169083058 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl 2-(6-oxo-1H-pyrimidin-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1c1cnc[nH]c1=O |
| InChI | InChI=1S/C13H20N4O3/c1-13(2,3)20-12(19)17-5-4-14-7-10(17)9-6-15-8-16-11(9)18/h6,8,10,14H,4-5,7H2,1-3H3,(H,15,16,18) |
| InChIKey | AICNFESFVAVVLI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |