C16H24FN3O3 — CID 176897650
tert-butyl 2-(4-amino-2-fluoro-3-methoxyphenyl)piperazine-1-carboxylate (PubChem CID 176897650) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is tert-butyl 2-(4-amino-2-fluoro-3-methoxyphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-amino-2-fluoro-3-methoxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176897650 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | tert-butyl 2-(4-amino-2-fluoro-3-methoxyphenyl)piperazine-1-carboxylate |
| SMILES | COc1c(N)ccc(C2CNCCN2C(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C16H24FN3O3/c1-16(2,3)23-15(21)20-8-7-19-9-12(20)10-5-6-11(18)14(22-4)13(10)17/h5-6,12,19H,7-9,18H2,1-4H3 |
| InChIKey | ZUNDMXFMEMGIFK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|