C31H37N3O8S2 — CID 169083145
(2R)-2,6-diamino-2-[[4-[3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propanoyl]benzoyl]amino]hexanoic acid (PubChem CID 169083145) has the molecular formula C31H37N3O8S2 and a molecular weight of 643.78 g/mol. Its IUPAC name is (2R)-2,6-diamino-2-[[4-[3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propanoyl]benzoyl]amino]hexanoic acid.
| Compound Name | (2R)-2,6-diamino-2-[[4-[3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propanoyl]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 169083145 |
| Molecular Formula | C31H37N3O8S2 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.20 |
| IUPAC Name | (2R)-2,6-diamino-2-[[4-[3-(4-methylphenyl)sulfonyl-2-[(4-methylphenyl)sulfonylmethyl]propanoyl]benzoyl]amino]hexanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)CC(CS(=O)(=O)c2ccc(C)cc2)C(=O)c2ccc(C(=O)N[C@](N)(CCCCN)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O8S2/c1-21-5-13-26(14-6-21)43(39,40)19-25(20-44(41,42)27-15-7-22(2)8-16-27)28(35)23-9-11-24(12-10-23)29(36)34-31(33,30(37)38)17-3-4-18-32/h5-16,25H,3-4,17-20,32-33H2,1-2H3,(H,34,36)(H,37,38)/t31-/m1/s1 |
| InChIKey | OHCIEECHKPQFDR-WJOKGBTCSA-N |
| XLogP | 2.65 |
| TPSA | 203.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|