C15H22O2Si — CID 169083470
2-(2,4-diethoxyphenyl)ethynyl-trimethylsilane (PubChem CID 169083470) has the molecular formula C15H22O2Si and a molecular weight of 262.42 g/mol. Its IUPAC name is 2-(2,4-diethoxyphenyl)ethynyl-trimethylsilane.
| Compound Name | 2-(2,4-diethoxyphenyl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 169083470 |
| Molecular Formula | C15H22O2Si |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(2,4-diethoxyphenyl)ethynyl-trimethylsilane |
| SMILES | CCOc1ccc(C#C[Si](C)(C)C)c(OCC)c1 |
| InChI | InChI=1S/C15H22O2Si/c1-6-16-14-9-8-13(10-11-18(3,4)5)15(12-14)17-7-2/h8-9,12H,6-7H2,1-5H3 |
| InChIKey | SEQKPDZLQNZTJH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|