C26H33N3O3S — CID 169083825
3-(ethylsulfonylamino)-N-prop-2-enyl-2-[[3-(2-prop-2-enylphenyl)phenyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 169083825) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is 3-(ethylsulfonylamino)-N-prop-2-enyl-2-[[3-(2-prop-2-enylphenyl)phenyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-(ethylsulfonylamino)-N-prop-2-enyl-2-[[3-(2-prop-2-enylphenyl)phenyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 169083825 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-(ethylsulfonylamino)-N-prop-2-enyl-2-[[3-(2-prop-2-enylphenyl)phenyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCC(NS(=O)(=O)CC)C1Cc1cccc(-c2ccccc2CC=C)c1 |
| InChI | InChI=1S/C26H33N3O3S/c1-4-10-21-12-7-8-14-23(21)22-13-9-11-20(18-22)19-25-24(28-33(31,32)6-3)15-17-29(25)26(30)27-16-5-2/h4-5,7-9,11-14,18,24-25,28H,1-2,6,10,15-17,19H2,3H3,(H,27,30) |
| InChIKey | VKKPXFURQLMNEF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|