C18H24BrN3O3S — CID 169083887
N-[2-[(3-bromophenyl)methyl]-1-(3-ethenylazetidine-1-carbonyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 169083887) has the molecular formula C18H24BrN3O3S and a molecular weight of 442.38 g/mol. Its IUPAC name is N-[2-[(3-bromophenyl)methyl]-1-(3-ethenylazetidine-1-carbonyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | N-[2-[(3-bromophenyl)methyl]-1-(3-ethenylazetidine-1-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 169083887 |
| Molecular Formula | C18H24BrN3O3S |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | N-[2-[(3-bromophenyl)methyl]-1-(3-ethenylazetidine-1-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | C=CC1CN(C(=O)N2CCC(NS(C)(=O)=O)C2Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C18H24BrN3O3S/c1-3-13-11-21(12-13)18(23)22-8-7-16(20-26(2,24)25)17(22)10-14-5-4-6-15(19)9-14/h3-6,9,13,16-17,20H,1,7-8,10-12H2,2H3 |
| InChIKey | OJDUPOMQYXDPOO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|