C16H24N2O5S — CID 169084356
1-(1,2-benzoxazol-3-yl)-N-(1,1-dimethoxyhexan-2-yl)methanesulfonamide (PubChem CID 169084356) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-yl)-N-(1,1-dimethoxyhexan-2-yl)methanesulfonamide.
| Compound Name | 1-(1,2-benzoxazol-3-yl)-N-(1,1-dimethoxyhexan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 169084356 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-(1,2-benzoxazol-3-yl)-N-(1,1-dimethoxyhexan-2-yl)methanesulfonamide |
| SMILES | CCCCC(NS(=O)(=O)Cc1noc2ccccc12)C(OC)OC |
| InChI | InChI=1S/C16H24N2O5S/c1-4-5-9-13(16(21-2)22-3)18-24(19,20)11-14-12-8-6-7-10-15(12)23-17-14/h6-8,10,13,16,18H,4-5,9,11H2,1-3H3 |
| InChIKey | WOSANBWARMJNAT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|