C20H15NO5 — CID 169087757
methyl 3-(2,5-dioxopyrrol-1-yl)-4-methyl-2H-benzo[h]chromene-2-carboxylate (PubChem CID 169087757) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is methyl 3-(2,5-dioxopyrrol-1-yl)-4-methyl-2H-benzo[h]chromene-2-carboxylate.
| Compound Name | methyl 3-(2,5-dioxopyrrol-1-yl)-4-methyl-2H-benzo[h]chromene-2-carboxylate |
|---|---|
| PubChem CID | 169087757 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | methyl 3-(2,5-dioxopyrrol-1-yl)-4-methyl-2H-benzo[h]chromene-2-carboxylate |
| SMILES | COC(=O)C1Oc2c(ccc3ccccc23)C(C)=C1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C20H15NO5/c1-11-13-8-7-12-5-3-4-6-14(12)18(13)26-19(20(24)25-2)17(11)21-15(22)9-10-16(21)23/h3-10,19H,1-2H3 |
| InChIKey | LMKYQZCEFWDFBE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|