C28H30N6O2S — CID 169089437
(E)-2-[(3S)-3-[8-amino-1-(7-methoxy-5-methyl-1-benzothiophen-2-yl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile (PubChem CID 169089437) has the molecular formula C28H30N6O2S and a molecular weight of 514.66 g/mol. Its IUPAC name is (E)-2-[(3S)-3-[8-amino-1-(7-methoxy-5-methyl-1-benzothiophen-2-yl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-[(3S)-3-[8-amino-1-(7-methoxy-5-methyl-1-benzothiophen-2-yl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 169089437 |
| Molecular Formula | C28H30N6O2S |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (E)-2-[(3S)-3-[8-amino-1-(7-methoxy-5-methyl-1-benzothiophen-2-yl)imidazo[1,5-a]pyrazin-3-yl]pyrrolidine-1-carbonyl]-4,4-dimethylpent-2-enenitrile |
| SMILES | COc1cc(C)cc2cc(-c3nc([C@H]4CCN(C(=O)/C(C#N)=C/C(C)(C)C)C4)n4ccnc(N)c34)sc12 |
| InChI | InChI=1S/C28H30N6O2S/c1-16-10-18-12-21(37-24(18)20(11-16)36-5)22-23-25(30)31-7-9-34(23)26(32-22)17-6-8-33(15-17)27(35)19(14-29)13-28(2,3)4/h7,9-13,17H,6,8,15H2,1-5H3,(H2,30,31)/b19-13+/t17-/m0/s1 |
| InChIKey | WEGXQDVBPXLWDC-AMRJIULGSA-N |
| XLogP | 5.32 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|